C20H18N4O6S2 — CID 20818055
4-[[3-cyano-4,5-dimethyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid (PubChem CID 20818055) has the molecular formula C20H18N4O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 4-[[3-cyano-4,5-dimethyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[3-cyano-4,5-dimethyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 20818055 |
| Molecular Formula | C20H18N4O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 4-[[3-cyano-4,5-dimethyl-6-(4-sulfoanilino)-2-pyridinyl]amino]benzenesulfonic acid |
| SMILES | Cc1c(Nc2ccc(S(=O)(=O)O)cc2)nc(Nc2ccc(S(=O)(=O)O)cc2)c(C#N)c1C |
| InChI | InChI=1S/C20H18N4O6S2/c1-12-13(2)19(22-14-3-7-16(8-4-14)31(25,26)27)24-20(18(12)11-21)23-15-5-9-17(10-6-15)32(28,29)30/h3-10H,1-2H3,(H2,22,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | UGGIQQOXCQGJOR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 169.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|