C29H36Cl4N4O6S2 — CID 20832802
4-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfobutyl)benzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-2H-benzimidazol-1-yl]butane-2-sulfonic acid (PubChem CID 20832802) has the molecular formula C29H36Cl4N4O6S2 and a molecular weight of 742.57 g/mol. Its IUPAC name is 4-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfobutyl)benzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-2H-benzimidazol-1-yl]butane-2-sulfonic acid.
| Compound Name | 4-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfobutyl)benzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-2H-benzimidazol-1-yl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 20832802 |
| Molecular Formula | C29H36Cl4N4O6S2 |
| Molecular Weight | 742.57 g/mol |
| Exact Mass | 740.08 |
| IUPAC Name | 4-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfobutyl)benzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-2H-benzimidazol-1-yl]butane-2-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/C2N(CC)c3cc(Cl)c(Cl)cc3N2CCC(C)S(=O)(=O)O)N(CCC(C)S(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C29H36Cl4N4O6S2/c1-5-34-24-14-20(30)22(32)16-26(24)36(12-10-18(3)44(38,39)40)28(34)8-7-9-29-35(6-2)25-15-21(31)23(33)17-27(25)37(29)13-11-19(4)45(41,42)43/h7-9,14-19,28H,5-6,10-13H2,1-4H3,(H,38,39,40)(H,41,42,43)/b8-7+,29-9- |
| InChIKey | DWWWPNIYXMBXIY-PRJNPEHLSA-N |
| XLogP | 7.35 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|