C8H14Cl2N2O4-2 — CID 20838097
(E)-2,3-bis(2-aminoethyl)but-2-enedioate;dihydrochloride (PubChem CID 20838097) has the molecular formula C8H14Cl2N2O4-2 and a molecular weight of 273.12 g/mol. Its IUPAC name is (E)-2,3-bis(2-aminoethyl)but-2-enedioate;dihydrochloride.
| Compound Name | (E)-2,3-bis(2-aminoethyl)but-2-enedioate;dihydrochloride |
|---|---|
| PubChem CID | 20838097 |
| Molecular Formula | C8H14Cl2N2O4-2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (E)-2,3-bis(2-aminoethyl)but-2-enedioate;dihydrochloride |
| SMILES | Cl.Cl.NCC/C(C(=O)[O-])=C(/CCN)C(=O)[O-] |
| InChI | InChI=1S/C8H14N2O4.2ClH/c9-3-1-5(7(11)12)6(2-4-10)8(13)14;;/h1-4,9-10H2,(H,11,12)(H,13,14);2*1H/p-2/b6-5+;; |
| InChIKey | WZZGBYHQVWDRJW-TXOOBNKBSA-L |
| XLogP | -2.68 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|