C25H27ClN4O6 — CID 20845325
ethyl (Z)-4-chloro-4-(4-cyclohexylphenyl)-3-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]but-3-enoate (PubChem CID 20845325) has the molecular formula C25H27ClN4O6 and a molecular weight of 514.97 g/mol. Its IUPAC name is ethyl (Z)-4-chloro-4-(4-cyclohexylphenyl)-3-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]but-3-enoate.
| Compound Name | ethyl (Z)-4-chloro-4-(4-cyclohexylphenyl)-3-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]but-3-enoate |
|---|---|
| PubChem CID | 20845325 |
| Molecular Formula | C25H27ClN4O6 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | ethyl (Z)-4-chloro-4-(4-cyclohexylphenyl)-3-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]but-3-enoate |
| SMILES | CCOC(=O)CC(/C=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])=C(/Cl)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27ClN4O6/c1-2-36-24(31)14-20(16-27-28-22-13-12-21(29(32)33)15-23(22)30(34)35)25(26)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h8-13,15-17,28H,2-7,14H2,1H3/b25-20-,27-16- |
| InChIKey | OWIQJTFWKBNZAE-WSVHJMTISA-N |
| XLogP | 6.55 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|