C16H15Cl2NO5S — CID 20850908
2-[2,4-dichloro-5-methoxy-3-(4-methylphenyl)sulfonylanilino]acetic acid (PubChem CID 20850908) has the molecular formula C16H15Cl2NO5S and a molecular weight of 404.27 g/mol. Its IUPAC name is 2-[2,4-dichloro-5-methoxy-3-(4-methylphenyl)sulfonylanilino]acetic acid.
| Compound Name | 2-[2,4-dichloro-5-methoxy-3-(4-methylphenyl)sulfonylanilino]acetic acid |
|---|---|
| PubChem CID | 20850908 |
| Molecular Formula | C16H15Cl2NO5S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-[2,4-dichloro-5-methoxy-3-(4-methylphenyl)sulfonylanilino]acetic acid |
| SMILES | COc1cc(NCC(=O)O)c(Cl)c(S(=O)(=O)c2ccc(C)cc2)c1Cl |
| InChI | InChI=1S/C16H15Cl2NO5S/c1-9-3-5-10(6-4-9)25(22,23)16-14(17)11(19-8-13(20)21)7-12(24-2)15(16)18/h3-7,19H,8H2,1-2H3,(H,20,21) |
| InChIKey | OZVZSILZOGMQCJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |