C42H75N9 — CID 20870641
2-N,4-N,6-N-trimethyl-2-N,4-N,6-N-tris(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 20870641) has the molecular formula C42H75N9 and a molecular weight of 706.12 g/mol. Its IUPAC name is 2-N,4-N,6-N-trimethyl-2-N,4-N,6-N-tris(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-trimethyl-2-N,4-N,6-N-tris(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20870641 |
| Molecular Formula | C42H75N9 |
| Molecular Weight | 706.12 g/mol |
| Exact Mass | 705.61 |
| IUPAC Name | 2-N,4-N,6-N-trimethyl-2-N,4-N,6-N-tris(2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCN1C(C)(C)CC(N(C)c2nc(N(C)C3CC(C)(C)N(CC=C)C(C)(C)C3)nc(N(C)C3CC(C)(C)N(CC=C)C(C)(C)C3)n2)CC1(C)C |
| InChI | InChI=1S/C42H75N9/c1-19-22-49-37(4,5)25-31(26-38(49,6)7)46(16)34-43-35(47(17)32-27-39(8,9)50(23-20-2)40(10,11)28-32)45-36(44-34)48(18)33-29-41(12,13)51(24-21-3)42(14,15)30-33/h19-21,31-33H,1-3,22-30H2,4-18H3 |
| InChIKey | HZWDWMOERIQEJD-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 58.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.12 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|