C28H37N3O3 — CID 20871735
4-(4-benzylpiperazin-1-yl)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)benzamide (PubChem CID 20871735) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)benzamide.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)benzamide |
|---|---|
| PubChem CID | 20871735 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)benzamide |
| SMILES | CC(C)C(=O)CC(NC(=O)c1ccc(N2CCN(Cc3ccccc3)CC2)cc1)C(=O)C(C)C |
| InChI | InChI=1S/C28H37N3O3/c1-20(2)26(32)18-25(27(33)21(3)4)29-28(34)23-10-12-24(13-11-23)31-16-14-30(15-17-31)19-22-8-6-5-7-9-22/h5-13,20-21,25H,14-19H2,1-4H3,(H,29,34) |
| InChIKey | NYPKAWQLEFSXMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |