C15H17NO4 — CID 2087378
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 3-phenoxypropanoate (PubChem CID 2087378) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 3-phenoxypropanoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 3-phenoxypropanoate |
|---|---|
| PubChem CID | 2087378 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 3-phenoxypropanoate |
| SMILES | Cc1noc(C)c1COC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C15H17NO4/c1-11-14(12(2)20-16-11)10-19-15(17)8-9-18-13-6-4-3-5-7-13/h3-7H,8-10H2,1-2H3 |
| InChIKey | VJFMXWCHMBOXGQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |