C16H15N3O5S2 — CID 20917588
methyl 2-[3-oxo-6-(pyridin-2-ylsulfamoyl)-1,4-benzothiazin-4-yl]acetate (PubChem CID 20917588) has the molecular formula C16H15N3O5S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is methyl 2-[3-oxo-6-(pyridin-2-ylsulfamoyl)-1,4-benzothiazin-4-yl]acetate.
| Compound Name | methyl 2-[3-oxo-6-(pyridin-2-ylsulfamoyl)-1,4-benzothiazin-4-yl]acetate |
|---|---|
| PubChem CID | 20917588 |
| Molecular Formula | C16H15N3O5S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | methyl 2-[3-oxo-6-(pyridin-2-ylsulfamoyl)-1,4-benzothiazin-4-yl]acetate |
| SMILES | COC(=O)CN1C(=O)CSc2ccc(S(=O)(=O)Nc3ccccn3)cc21 |
| InChI | InChI=1S/C16H15N3O5S2/c1-24-16(21)9-19-12-8-11(5-6-13(12)25-10-15(19)20)26(22,23)18-14-4-2-3-7-17-14/h2-8H,9-10H2,1H3,(H,17,18) |
| InChIKey | VMLMVLDQHUSBOD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |