C18H20F2N2O4S — CID 20931169
4-[butyl(methyl)amino]-3-[(2,5-difluorophenyl)sulfonylamino]benzoic acid (PubChem CID 20931169) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-[butyl(methyl)amino]-3-[(2,5-difluorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[butyl(methyl)amino]-3-[(2,5-difluorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 20931169 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[butyl(methyl)amino]-3-[(2,5-difluorophenyl)sulfonylamino]benzoic acid |
| SMILES | CCCCN(C)c1ccc(C(=O)O)cc1NS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H20F2N2O4S/c1-3-4-9-22(2)16-8-5-12(18(23)24)10-15(16)21-27(25,26)17-11-13(19)6-7-14(17)20/h5-8,10-11,21H,3-4,9H2,1-2H3,(H,23,24) |
| InChIKey | PVMRPJXTDQZOAI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |