C20H23ClN2O2 — CID 20970279
4-chloro-2-[4-(3-methoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 20970279) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 4-chloro-2-[4-(3-methoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-chloro-2-[4-(3-methoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 20970279 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-chloro-2-[4-(3-methoxyphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | COc1cccc(C2=NC(C(C)C)NC(c3cc(Cl)ccc3O)C2)c1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-12(2)20-22-17(13-5-4-6-15(9-13)25-3)11-18(23-20)16-10-14(21)7-8-19(16)24/h4-10,12,18,20,23-24H,11H2,1-3H3 |
| InChIKey | VCKHPLJVEOHZIB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|