About carbanide;1-ethyl-3-methylurea;yttrium(3+)
carbanide;1-ethyl-3-methylurea;yttrium(3+) (PubChem CID 21019715) has the molecular formula C5H12N2OY+
and a molecular weight of 205.07 g/mol. Its IUPAC name is carbanide;1-ethyl-3-methylurea;yttrium(3+).
Molecular Properties
| Compound Name | carbanide;1-ethyl-3-methylurea;yttrium(3+) |
| PubChem CID | 21019715 |
| Molecular Formula | C5H12N2OY+ |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | carbanide;1-ethyl-3-methylurea;yttrium(3+) |
| SMILES | [CH2-]CNC(=O)NC.[CH3-].[Y+3] |
| InChI | InChI=1S/C4H9N2O.CH3.Y/c1-3-6-4(7)5-2;;/h1,3H2,2H3,(H2,5,6,7);1H3;/q2*-1;+3 |
| InChIKey | WTAPFFGQEATROE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-ethyl-3-methylurea;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-ethyl-3-methylurea;yttrium(3+)?
The IUPAC name of carbanide;1-ethyl-3-methylurea;yttrium(3+) (CID 21019715) is carbanide;1-ethyl-3-methylurea;yttrium(3+).
What is the SMILES notation for carbanide;1-ethyl-3-methylurea;yttrium(3+)?
The canonical SMILES for carbanide;1-ethyl-3-methylurea;yttrium(3+) is [CH2-]CNC(=O)NC.[CH3-].[Y+3].
What is the InChIKey of carbanide;1-ethyl-3-methylurea;yttrium(3+)?
The InChIKey is WTAPFFGQEATROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2O.CH3.Y/c1-3-6-4(7)5-2;;/h1,3H2,2H3,(H2,5,6,7);1H3;/q2*-1;+3.
What are the key properties of carbanide;1-ethyl-3-methylurea;yttrium(3+)?
carbanide;1-ethyl-3-methylurea;yttrium(3+) has a molecular weight of 205.07 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-ethyl-3-methylurea;yttrium(3+) is sourced from PubChem (CID 21019715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).