C20H22Cl2N2O6 — CID 21021995
(2R)-6-[2-[[(2S)-3-(4-amino-3,5-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid (PubChem CID 21021995) has the molecular formula C20H22Cl2N2O6 and a molecular weight of 457.31 g/mol. Its IUPAC name is (2R)-6-[2-[[(2S)-3-(4-amino-3,5-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid.
| Compound Name | (2R)-6-[2-[[(2S)-3-(4-amino-3,5-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 21021995 |
| Molecular Formula | C20H22Cl2N2O6 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (2R)-6-[2-[[(2S)-3-(4-amino-3,5-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl]-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid |
| SMILES | Nc1c(Cl)cc(OC[C@@H](O)CNCCc2ccc3c(c2)OC[C@H](C(=O)O)O3)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O6/c21-14-6-13(7-15(22)19(14)23)28-9-12(25)8-24-4-3-11-1-2-16-17(5-11)29-10-18(30-16)20(26)27/h1-2,5-7,12,18,24-25H,3-4,8-10,23H2,(H,26,27)/t12-,18+/m0/s1 |
| InChIKey | KOHKTEVZQZYEDB-KPZWWZAWSA-N |
| XLogP | 2.37 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|