C18H17N7O — CID 21030622
4-(furan-2-yl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine (PubChem CID 21030622) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine |
|---|---|
| PubChem CID | 21030622 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-(furan-2-yl)-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-7-amine |
| SMILES | Nc1nc2c(c3nc(-c4ccco4)nn13)CNN2CCc1ccccc1 |
| InChI | InChI=1S/C18H17N7O/c19-18-22-16-13(11-20-24(16)9-8-12-5-2-1-3-6-12)17-21-15(23-25(17)18)14-7-4-10-26-14/h1-7,10,20H,8-9,11H2,(H2,19,22) |
| InChIKey | XYVLWMXGRPNVQK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |