C15H13Br2N5O6S2 — CID 21044453
[4-[(4-aminoperoxysulfanyloxy-3-bromophenyl)-(1,2,4-triazol-1-yl)methyl]-2-bromophenyl] sulfamate (PubChem CID 21044453) has the molecular formula C15H13Br2N5O6S2 and a molecular weight of 583.24 g/mol. Its IUPAC name is [4-[(4-aminoperoxysulfanyloxy-3-bromophenyl)-(1,2,4-triazol-1-yl)methyl]-2-bromophenyl] sulfamate.
| Compound Name | [4-[(4-aminoperoxysulfanyloxy-3-bromophenyl)-(1,2,4-triazol-1-yl)methyl]-2-bromophenyl] sulfamate |
|---|---|
| PubChem CID | 21044453 |
| Molecular Formula | C15H13Br2N5O6S2 |
| Molecular Weight | 583.24 g/mol |
| Exact Mass | 580.87 |
| IUPAC Name | [4-[(4-aminoperoxysulfanyloxy-3-bromophenyl)-(1,2,4-triazol-1-yl)methyl]-2-bromophenyl] sulfamate |
| SMILES | NOOSOc1ccc(C(c2ccc(OS(N)(=O)=O)c(Br)c2)n2cncn2)cc1Br |
| InChI | InChI=1S/C15H13Br2N5O6S2/c16-11-5-9(1-3-13(11)25-29-28-27-18)15(22-8-20-7-21-22)10-2-4-14(12(17)6-10)26-30(19,23)24/h1-8,15H,18H2,(H2,19,23,24) |
| InChIKey | MNQNDXJJBZLTQE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|