C37H43NO4S — CID 21046557
methyl 5-[4-(2-methylpropyl)phenyl]-3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 21046557) has the molecular formula C37H43NO4S and a molecular weight of 597.82 g/mol. Its IUPAC name is methyl 5-[4-(2-methylpropyl)phenyl]-3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-[4-(2-methylpropyl)phenyl]-3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 21046557 |
| Molecular Formula | C37H43NO4S |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | methyl 5-[4-(2-methylpropyl)phenyl]-3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccc(CC(C)C)cc2)cc1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)CCC3(C)C)o1 |
| InChI | InChI=1S/C37H43NO4S/c1-22(2)17-24-9-11-25(12-10-24)32-21-30(33(43-32)35(40)41-8)38-34(39)31-14-13-27(42-31)19-26-20-29-28(18-23(26)3)36(4,5)15-16-37(29,6)7/h9-14,18,20-22H,15-17,19H2,1-8H3,(H,38,39) |
| InChIKey | PGWBVZTUWBNHLN-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |