C14H19N5S — CID 21083782
N,12-dimethyl-4-pentan-3-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 21083782) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is N,12-dimethyl-4-pentan-3-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | N,12-dimethyl-4-pentan-3-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 21083782 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N,12-dimethyl-4-pentan-3-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CCC(CC)c1nc2c(nc(NC)c3ncn(C)c32)s1 |
| InChI | InChI=1S/C14H19N5S/c1-5-8(6-2)13-17-10-11-9(16-7-19(11)4)12(15-3)18-14(10)20-13/h7-8H,5-6H2,1-4H3,(H,15,18) |
| InChIKey | SXFRJUUSBLBWOV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |