C14H16N6O3S — CID 58801591
ethyl 3-[[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]amino]-3-oxopropanoate (PubChem CID 58801591) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is ethyl 3-[[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 58801591 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | ethyl 3-[[12-methyl-8-(methylamino)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-4-yl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1nc2c(nc(NC)c3ncn(C)c32)s1 |
| InChI | InChI=1S/C14H16N6O3S/c1-4-23-8(22)5-7(21)17-14-18-10-11-9(16-6-20(11)3)12(15-2)19-13(10)24-14/h6H,4-5H2,1-3H3,(H,15,19)(H,17,18,21) |
| InChIKey | AATUPVFTPKMDQU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|