C11H9Cl2NO2 — CID 21092925
3-benzyl-1,2-oxazole;carbonyl dichloride (PubChem CID 21092925) has the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. Its IUPAC name is 3-benzyl-1,2-oxazole;carbonyl dichloride.
| Compound Name | 3-benzyl-1,2-oxazole;carbonyl dichloride |
|---|---|
| PubChem CID | 21092925 |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 3-benzyl-1,2-oxazole;carbonyl dichloride |
| SMILES | O=C(Cl)Cl.c1ccc(Cc2ccon2)cc1 |
| InChI | InChI=1S/C10H9NO.CCl2O/c1-2-4-9(5-3-1)8-10-6-7-12-11-10;2-1(3)4/h1-7H,8H2; |
| InChIKey | KKHYHSSHNLRSJR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|