About 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid
5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 21116373) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 21116373 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC(C)(C)C1=CC=CC(C(=O)O)C1(O)C(C)(C)C |
| InChI | InChI=1S/C15H24O3/c1-13(2,3)11-9-7-8-10(12(16)17)15(11,18)14(4,5)6/h7-10,18H,1-6H3,(H,16,17) |
| InChIKey | PMQWTSCWKOZVCT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 21116373) is 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid is CC(C)(C)C1=CC=CC(C(=O)O)C1(O)C(C)(C)C.
What is the InChIKey of 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is PMQWTSCWKOZVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-13(2,3)11-9-7-8-10(12(16)17)15(11,18)14(4,5)6/h7-10,18H,1-6H3,(H,16,17).
What are the key properties of 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 252.35 g/mol, XLogP of 3.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 21116373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).