C31H34N2O2 — CID 21121921
1-[4-[1-(diethylamino)ethoxy]phenyl]-1,2-diphenyl-2-pyridin-4-ylethanol (PubChem CID 21121921) has the molecular formula C31H34N2O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-[4-[1-(diethylamino)ethoxy]phenyl]-1,2-diphenyl-2-pyridin-4-ylethanol.
| Compound Name | 1-[4-[1-(diethylamino)ethoxy]phenyl]-1,2-diphenyl-2-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 21121921 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-[4-[1-(diethylamino)ethoxy]phenyl]-1,2-diphenyl-2-pyridin-4-ylethanol |
| SMILES | CCN(CC)C(C)Oc1ccc(C(O)(c2ccccc2)C(c2ccccc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C31H34N2O2/c1-4-33(5-2)24(3)35-29-18-16-28(17-19-29)31(34,27-14-10-7-11-15-27)30(25-12-8-6-9-13-25)26-20-22-32-23-21-26/h6-24,30,34H,4-5H2,1-3H3 |
| InChIKey | ZIPLGTFNTCXXSB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|