C23H27ClN3O2 — CID 21123047
CID 21123047 (PubChem CID 21123047) has the molecular formula C23H27ClN3O2 and a molecular weight of 412.94 g/mol.
| Compound Name | CID 21123047 |
|---|---|
| PubChem CID | 21123047 |
| Molecular Formula | C23H27ClN3O2 |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | — |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NC3CC(C)(C)N([O])C(C)(C)C3)c2c1 |
| InChI | InChI=1S/C23H27ClN3O2/c1-22(2)12-15(13-23(3,4)27(22)28)25-21-17-8-6-14(24)10-20(17)26-19-9-7-16(29-5)11-18(19)21/h6-11,15H,12-13H2,1-5H3,(H,25,26) |
| InChIKey | YVCUSWLQOOYIIF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 57.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|