About carbanide;N-propylacetamide;tungsten(2+)
carbanide;N-propylacetamide;tungsten(2+) (PubChem CID 21133739) has the molecular formula C6H13NOW
and a molecular weight of 299.02 g/mol. Its IUPAC name is carbanide;N-propylacetamide;tungsten(2+).
Molecular Properties
| Compound Name | carbanide;N-propylacetamide;tungsten(2+) |
| PubChem CID | 21133739 |
| Molecular Formula | C6H13NOW |
| Molecular Weight | 299.02 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | carbanide;N-propylacetamide;tungsten(2+) |
| SMILES | [CH2-]CCNC(C)=O.[CH3-].[W+2] |
| InChI | InChI=1S/C5H10NO.CH3.W/c1-3-4-6-5(2)7;;/h1,3-4H2,2H3,(H,6,7);1H3;/q2*-1;+2 |
| InChIKey | YGPKOPPSWHKCTF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.02 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;N-propylacetamide;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;N-propylacetamide;tungsten(2+)?
The IUPAC name of carbanide;N-propylacetamide;tungsten(2+) (CID 21133739) is carbanide;N-propylacetamide;tungsten(2+).
What is the SMILES notation for carbanide;N-propylacetamide;tungsten(2+)?
The canonical SMILES for carbanide;N-propylacetamide;tungsten(2+) is [CH2-]CCNC(C)=O.[CH3-].[W+2].
What is the InChIKey of carbanide;N-propylacetamide;tungsten(2+)?
The InChIKey is YGPKOPPSWHKCTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO.CH3.W/c1-3-4-6-5(2)7;;/h1,3-4H2,2H3,(H,6,7);1H3;/q2*-1;+2.
What are the key properties of carbanide;N-propylacetamide;tungsten(2+)?
carbanide;N-propylacetamide;tungsten(2+) has a molecular weight of 299.02 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;N-propylacetamide;tungsten(2+) is sourced from PubChem (CID 21133739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).