C22H23NOP+ — CID 21135271
2,2,7-trimethyl-1,5-diphenyl-3H-4,2,1-benzoxazaphosphinin-2-ium (PubChem CID 21135271) has the molecular formula C22H23NOP+ and a molecular weight of 348.41 g/mol. Its IUPAC name is 2,2,7-trimethyl-1,5-diphenyl-3H-4,2,1-benzoxazaphosphinin-2-ium.
| Compound Name | 2,2,7-trimethyl-1,5-diphenyl-3H-4,2,1-benzoxazaphosphinin-2-ium |
|---|---|
| PubChem CID | 21135271 |
| Molecular Formula | C22H23NOP+ |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2,2,7-trimethyl-1,5-diphenyl-3H-4,2,1-benzoxazaphosphinin-2-ium |
| SMILES | Cc1cc(-c2ccccc2)c2c(c1)P(c1ccccc1)[N+](C)(C)CO2 |
| InChI | InChI=1S/C22H23NOP/c1-17-14-20(18-10-6-4-7-11-18)22-21(15-17)25(23(2,3)16-24-22)19-12-8-5-9-13-19/h4-15H,16H2,1-3H3/q+1 |
| InChIKey | VHAIIAMEQOAASP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|