C23H15Br2N3O4S — CID 21171169
3,5-dibromo-N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 21171169) has the molecular formula C23H15Br2N3O4S and a molecular weight of 589.27 g/mol. Its IUPAC name is 3,5-dibromo-N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 21171169 |
| Molecular Formula | C23H15Br2N3O4S |
| Molecular Weight | 589.27 g/mol |
| Exact Mass | 586.92 |
| IUPAC Name | 3,5-dibromo-N-[[4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H15Br2N3O4S/c1-32-19-17(10-12(24)11-18(19)25)20(29)27-23(33)26-13-6-8-14(9-7-13)28-21(30)15-4-2-3-5-16(15)22(28)31/h2-11H,1H3,(H2,26,27,29,33) |
| InChIKey | CVIHQWPMYWFKTA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|