C20H18F3N7O4S — CID 2117797
4-(1-methyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-nitrobenzamide (PubChem CID 2117797) has the molecular formula C20H18F3N7O4S and a molecular weight of 509.47 g/mol. Its IUPAC name is 4-(1-methyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-(1-methyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2117797 |
| Molecular Formula | C20H18F3N7O4S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 4-(1-methyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-3-nitrobenzamide |
| SMILES | Cn1nnnc1Sc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18F3N7O4S/c1-28-19(25-26-27-28)35-17-5-2-12(10-16(17)30(32)33)18(31)24-14-11-13(20(21,22)23)3-4-15(14)29-6-8-34-9-7-29/h2-5,10-11H,6-9H2,1H3,(H,24,31) |
| InChIKey | DGHDQCBQFCFNKK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|