C6H15N2O2P-2 — CID 21195288
2-dioxidophosphanyl-1,1-di(propan-2-yl)hydrazine (PubChem CID 21195288) has the molecular formula C6H15N2O2P-2 and a molecular weight of 178.17 g/mol. Its IUPAC name is 2-dioxidophosphanyl-1,1-di(propan-2-yl)hydrazine.
| Compound Name | 2-dioxidophosphanyl-1,1-di(propan-2-yl)hydrazine |
|---|---|
| PubChem CID | 21195288 |
| Molecular Formula | C6H15N2O2P-2 |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-dioxidophosphanyl-1,1-di(propan-2-yl)hydrazine |
| SMILES | CC(C)N(NP([O-])[O-])C(C)C |
| InChI | InChI=1S/C6H15N2O2P/c1-5(2)8(6(3)4)7-11(9)10/h5-7H,1-4H3/q-2 |
| InChIKey | NXMAGKPLMZHDNZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|