C19H21N5 — CID 21222868
N,N-diethyl-4-[(5-imino-1-phenylpyrazol-4-ylidene)amino]aniline (PubChem CID 21222868) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is N,N-diethyl-4-[(5-imino-1-phenylpyrazol-4-ylidene)amino]aniline.
| Compound Name | N,N-diethyl-4-[(5-imino-1-phenylpyrazol-4-ylidene)amino]aniline |
|---|---|
| PubChem CID | 21222868 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N,N-diethyl-4-[(5-imino-1-phenylpyrazol-4-ylidene)amino]aniline |
| SMILES | [H]/N=C1C(=N\c2ccc(N(CC)CC)cc2)\C=NN\1c1ccccc1 |
| InChI | InChI=1S/C19H21N5/c1-3-23(4-2)16-12-10-15(11-13-16)22-18-14-21-24(19(18)20)17-8-6-5-7-9-17/h5-14,20H,3-4H2,1-2H3/b20-19+,22-18+ |
| InChIKey | JCHLRHKKJUOYFA-LWEJJHOBSA-N |
| XLogP | 4.09 |
| TPSA | 55.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|