C18H28N6 — CID 21222826
4-[4-(diethylamino)phenyl]imino-5-imino-N,N-dimethyl-1-propan-2-ylpyrazol-3-amine (PubChem CID 21222826) has the molecular formula C18H28N6 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-[4-(diethylamino)phenyl]imino-5-imino-N,N-dimethyl-1-propan-2-ylpyrazol-3-amine.
| Compound Name | 4-[4-(diethylamino)phenyl]imino-5-imino-N,N-dimethyl-1-propan-2-ylpyrazol-3-amine |
|---|---|
| PubChem CID | 21222826 |
| Molecular Formula | C18H28N6 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 4-[4-(diethylamino)phenyl]imino-5-imino-N,N-dimethyl-1-propan-2-ylpyrazol-3-amine |
| SMILES | [H]/N=C1C(=N/c2ccc(N(CC)CC)cc2)\C(N(C)C)=NN\1C(C)C |
| InChI | InChI=1S/C18H28N6/c1-7-23(8-2)15-11-9-14(10-12-15)20-16-17(19)24(13(3)4)21-18(16)22(5)6/h9-13,19H,7-8H2,1-6H3/b19-17+,20-16+ |
| InChIKey | LLQFQXYZOYPKEF-BHMQALMUSA-N |
| XLogP | 3.18 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|