C28H29N2P — CID 134935584
N,N-diethyl-4-[(triphenyl-λ5-phosphanylidene)amino]aniline (PubChem CID 134935584) has the molecular formula C28H29N2P and a molecular weight of 424.53 g/mol. Its IUPAC name is N,N-diethyl-4-[(triphenyl-λ5-phosphanylidene)amino]aniline.
| Compound Name | N,N-diethyl-4-[(triphenyl-λ5-phosphanylidene)amino]aniline |
|---|---|
| PubChem CID | 134935584 |
| Molecular Formula | C28H29N2P |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N,N-diethyl-4-[(triphenyl-λ5-phosphanylidene)amino]aniline |
| SMILES | CCN(CC)c1ccc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N2P/c1-3-30(4-2)25-22-20-24(21-23-25)29-31(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-23H,3-4H2,1-2H3 |
| InChIKey | MUCJMWGDSAZLTO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|