C23H12Cl2N2O3S — CID 21235330
6,8-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 21235330) has the molecular formula C23H12Cl2N2O3S and a molecular weight of 467.33 g/mol. Its IUPAC name is 6,8-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 21235330 |
| Molecular Formula | C23H12Cl2N2O3S |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 6,8-dichloro-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc3ccccc3c2)cs1)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C23H12Cl2N2O3S/c24-16-8-15-9-17(22(29)30-20(15)18(25)10-16)21(28)27-23-26-19(11-31-23)14-6-5-12-3-1-2-4-13(12)7-14/h1-11H,(H,26,27,28) |
| InChIKey | NITCGSCYBFWFSW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|