C25H12Cl2N2O11S2 — CID 21239751
bis(4-chlorophenyl) 4,5-dinitro-9-oxofluorene-2,7-disulfonate (PubChem CID 21239751) has the molecular formula C25H12Cl2N2O11S2 and a molecular weight of 651.41 g/mol. Its IUPAC name is bis(4-chlorophenyl) 4,5-dinitro-9-oxofluorene-2,7-disulfonate.
| Compound Name | bis(4-chlorophenyl) 4,5-dinitro-9-oxofluorene-2,7-disulfonate |
|---|---|
| PubChem CID | 21239751 |
| Molecular Formula | C25H12Cl2N2O11S2 |
| Molecular Weight | 651.41 g/mol |
| Exact Mass | 649.93 |
| IUPAC Name | bis(4-chlorophenyl) 4,5-dinitro-9-oxofluorene-2,7-disulfonate |
| SMILES | O=C1c2cc(S(=O)(=O)Oc3ccc(Cl)cc3)cc([N+](=O)[O-])c2-c2c1cc(S(=O)(=O)Oc1ccc(Cl)cc1)cc2[N+](=O)[O-] |
| InChI | InChI=1S/C25H12Cl2N2O11S2/c26-13-1-5-15(6-2-13)39-41(35,36)17-9-19-23(21(11-17)28(31)32)24-20(25(19)30)10-18(12-22(24)29(33)34)42(37,38)40-16-7-3-14(27)4-8-16/h1-12H |
| InChIKey | VTLVRXDMBYULRN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 190.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|