C27H20Cl2N2O6S2 — CID 71945455
bis(4-chlorophenyl) 9-(dimethylhydrazinylidene)fluorene-2,7-disulfonate (PubChem CID 71945455) has the molecular formula C27H20Cl2N2O6S2 and a molecular weight of 603.51 g/mol. Its IUPAC name is bis(4-chlorophenyl) 9-(dimethylhydrazinylidene)fluorene-2,7-disulfonate.
| Compound Name | bis(4-chlorophenyl) 9-(dimethylhydrazinylidene)fluorene-2,7-disulfonate |
|---|---|
| PubChem CID | 71945455 |
| Molecular Formula | C27H20Cl2N2O6S2 |
| Molecular Weight | 603.51 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | bis(4-chlorophenyl) 9-(dimethylhydrazinylidene)fluorene-2,7-disulfonate |
| SMILES | CN(C)N=C1c2cc(S(=O)(=O)Oc3ccc(Cl)cc3)ccc2-c2ccc(S(=O)(=O)Oc3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C27H20Cl2N2O6S2/c1-31(2)30-27-25-15-21(38(32,33)36-19-7-3-17(28)4-8-19)11-13-23(25)24-14-12-22(16-26(24)27)39(34,35)37-20-9-5-18(29)6-10-20/h3-16H,1-2H3 |
| InChIKey | NUTFMLLVBPUZFT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|