C14H8INO5S — CID 56587278
(4-iodophenyl) 1,3-dioxoisoindole-5-sulfonate (PubChem CID 56587278) has the molecular formula C14H8INO5S and a molecular weight of 429.19 g/mol. Its IUPAC name is (4-iodophenyl) 1,3-dioxoisoindole-5-sulfonate.
| Compound Name | (4-iodophenyl) 1,3-dioxoisoindole-5-sulfonate |
|---|---|
| PubChem CID | 56587278 |
| Molecular Formula | C14H8INO5S |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 428.92 |
| IUPAC Name | (4-iodophenyl) 1,3-dioxoisoindole-5-sulfonate |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)Oc3ccc(I)cc3)ccc21 |
| InChI | InChI=1S/C14H8INO5S/c15-8-1-3-9(4-2-8)21-22(19,20)10-5-6-11-12(7-10)14(18)16-13(11)17/h1-7H,(H,16,17,18) |
| InChIKey | BTPRJLSXSOMWSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|