C25H37N3O4 — CID 21264337
propyl 3-[[5-carbamoyl-1-[3-(dimethylamino)propyl]-9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]propanoate (PubChem CID 21264337) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is propyl 3-[[5-carbamoyl-1-[3-(dimethylamino)propyl]-9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]propanoate.
| Compound Name | propyl 3-[[5-carbamoyl-1-[3-(dimethylamino)propyl]-9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]propanoate |
|---|---|
| PubChem CID | 21264337 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | propyl 3-[[5-carbamoyl-1-[3-(dimethylamino)propyl]-9-methyl-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]propanoate |
| SMILES | CCCOC(=O)CCOc1cc(CCCN(C)C)c2c(c1)c1c(n2C)CCCC1C(N)=O |
| InChI | InChI=1S/C25H37N3O4/c1-5-13-32-22(29)11-14-31-18-15-17(8-7-12-27(2)3)24-20(16-18)23-19(25(26)30)9-6-10-21(23)28(24)4/h15-16,19H,5-14H2,1-4H3,(H2,26,30) |
| InChIKey | NYZSAPWJVMMXEY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|