About 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate
3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate (PubChem CID 21269305) has the molecular formula C14H13N3O6-2
and a molecular weight of 319.27 g/mol. Its IUPAC name is 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate.
Molecular Properties
| Compound Name | 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate |
| PubChem CID | 21269305 |
| Molecular Formula | C14H13N3O6-2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate |
| SMILES | CC1CC(n2cncc2C(=O)[O-])c2ccccc2O1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C14H14N2O3.NO3/c1-9-6-11(10-4-2-3-5-13(10)19-9)16-8-15-7-12(16)14(17)18;2-1(3)4/h2-5,7-9,11H,6H2,1H3,(H,17,18);/q;-1/p-1 |
| InChIKey | MYHPEVSYRCCNQF-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 133.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate?
The IUPAC name of 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate (CID 21269305) is 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate.
What is the SMILES notation for 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate?
The canonical SMILES for 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate is CC1CC(n2cncc2C(=O)[O-])c2ccccc2O1.O=[N+]([O-])[O-].
What is the InChIKey of 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate?
The InChIKey is MYHPEVSYRCCNQF-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H14N2O3.NO3/c1-9-6-11(10-4-2-3-5-13(10)19-9)16-8-15-7-12(16)14(17)18;2-1(3)4/h2-5,7-9,11H,6H2,1H3,(H,17,18);/q;-1/p-1.
What are the key properties of 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate?
3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate has a molecular weight of 319.27 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate is sourced from PubChem (CID 21269305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).