C14H13N3O6-2 — CID 21269305
3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate (PubChem CID 21269305) has the molecular formula C14H13N3O6-2 and a molecular weight of 319.27 g/mol. Its IUPAC name is 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate.
| Compound Name | 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate |
|---|---|
| PubChem CID | 21269305 |
| Molecular Formula | C14H13N3O6-2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-(2-methyl-3,4-dihydro-2H-chromen-4-yl)imidazole-4-carboxylate nitrate |
| SMILES | CC1CC(n2cncc2C(=O)[O-])c2ccccc2O1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C14H14N2O3.NO3/c1-9-6-11(10-4-2-3-5-13(10)19-9)16-8-15-7-12(16)14(17)18;2-1(3)4/h2-5,7-9,11H,6H2,1H3,(H,17,18);/q;-1/p-1 |
| InChIKey | MYHPEVSYRCCNQF-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 133.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|