C17H18FN3O8S — CID 21271396
(4-nitrophenyl)methyl 6-[2-fluoroethyl(methylsulfonyl)amino]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 21271396) has the molecular formula C17H18FN3O8S and a molecular weight of 443.41 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 6-[2-fluoroethyl(methylsulfonyl)amino]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 6-[2-fluoroethyl(methylsulfonyl)amino]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 21271396 |
| Molecular Formula | C17H18FN3O8S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (4-nitrophenyl)methyl 6-[2-fluoroethyl(methylsulfonyl)amino]-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CS(=O)(=O)N(CCF)C1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)C(=O)CC12 |
| InChI | InChI=1S/C17H18FN3O8S/c1-30(27,28)19(7-6-18)14-12-8-13(22)15(20(12)16(14)23)17(24)29-9-10-2-4-11(5-3-10)21(25)26/h2-5,12,14-15H,6-9H2,1H3 |
| InChIKey | INUORKKVWNMIQL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|