C9H10BF4NO2 — CID 21291758
2-ethyl-1,2-benzoxazol-2-ium-7-ol tetrafluoroborate (PubChem CID 21291758) has the molecular formula C9H10BF4NO2 and a molecular weight of 250.99 g/mol. Its IUPAC name is 2-ethyl-1,2-benzoxazol-2-ium-7-ol tetrafluoroborate.
| Compound Name | 2-ethyl-1,2-benzoxazol-2-ium-7-ol tetrafluoroborate |
|---|---|
| PubChem CID | 21291758 |
| Molecular Formula | C9H10BF4NO2 |
| Molecular Weight | 250.99 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-ethyl-1,2-benzoxazol-2-ium-7-ol tetrafluoroborate |
| SMILES | CC[n+]1cc2cccc(O)c2o1.F[B-](F)(F)F |
| InChI | InChI=1S/C9H9NO2.BF4/c1-2-10-6-7-4-3-5-8(11)9(7)12-10;2-1(3,4)5/h3-6H,2H2,1H3;/q;-1/p+1 |
| InChIKey | YCTQYZNTVCRACX-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.99 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|