C23H26F4NO2+ — CID 21299445
1-(4-fluorophenyl)-4-[4-hydroxy-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-1-ium-1-yl]butan-1-one (PubChem CID 21299445) has the molecular formula C23H26F4NO2+ and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[4-hydroxy-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-1-ium-1-yl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[4-hydroxy-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-1-ium-1-yl]butan-1-one |
|---|---|
| PubChem CID | 21299445 |
| Molecular Formula | C23H26F4NO2+ |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[4-hydroxy-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidin-1-ium-1-yl]butan-1-one |
| SMILES | C[N+]1(CCCC(=O)c2ccc(F)cc2)CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H26F4NO2/c1-28(13-3-6-21(29)17-7-9-20(24)10-8-17)14-11-22(30,12-15-28)18-4-2-5-19(16-18)23(25,26)27/h2,4-5,7-10,16,30H,3,6,11-15H2,1H3/q+1 |
| InChIKey | QWYYKWUEVJYMMS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|