C25H32FN3O2+2 — CID 21299479
3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1,4-dimethylpiperidin-1-ium-4-yl]-3-methyl-1H-benzimidazol-3-ium-2-one (PubChem CID 21299479) has the molecular formula C25H32FN3O2+2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1,4-dimethylpiperidin-1-ium-4-yl]-3-methyl-1H-benzimidazol-3-ium-2-one.
| Compound Name | 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1,4-dimethylpiperidin-1-ium-4-yl]-3-methyl-1H-benzimidazol-3-ium-2-one |
|---|---|
| PubChem CID | 21299479 |
| Molecular Formula | C25H32FN3O2+2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 3-[1-[4-(4-fluorophenyl)-4-oxobutyl]-1,4-dimethylpiperidin-1-ium-4-yl]-3-methyl-1H-benzimidazol-3-ium-2-one |
| SMILES | CC1([N+]2(C)C(=O)Nc3ccccc32)CC[N+](C)(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H31FN3O2/c1-25(29(3)22-8-5-4-7-21(22)27-24(29)31)14-17-28(2,18-15-25)16-6-9-23(30)19-10-12-20(26)13-11-19/h4-5,7-8,10-13H,6,9,14-18H2,1-3H3/q+1/p+1 |
| InChIKey | XPYLUZDIDYTTLL-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|