C18H41N7O6 — CID 21299844
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S,3S)-2-amino-3-methylpentanoic acid;(2S)-2,6-diaminohexanoic acid (PubChem CID 21299844) has the molecular formula C18H41N7O6 and a molecular weight of 451.57 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S,3S)-2-amino-3-methylpentanoic acid;(2S)-2,6-diaminohexanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S,3S)-2-amino-3-methylpentanoic acid;(2S)-2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 21299844 |
| Molecular Formula | C18H41N7O6 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S,3S)-2-amino-3-methylpentanoic acid;(2S)-2,6-diaminohexanoic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)O.NC(N)=NCCC[C@H](N)C(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C6H14N2O2.C6H13NO2/c7-4(5(11)12)2-1-3-10-6(8)9;7-4-2-1-3-5(8)6(9)10;1-3-4(2)5(7)6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);5H,1-4,7-8H2,(H,9,10);4-5H,3,7H2,1-2H3,(H,8,9)/t4-;5-;4-,5-/m000/s1 |
| InChIKey | WANYEUHNHBFPEH-QUMVCGSASA-N |
| XLogP | -1.58 |
| TPSA | 280.38 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|