C28H37N5O5 — CID 21302434
2-[2-[(4-carbamimidoylphenyl)carbamoyl]azepan-1-yl]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid (PubChem CID 21302434) has the molecular formula C28H37N5O5 and a molecular weight of 523.63 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]azepan-1-yl]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]azepan-1-yl]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 21302434 |
| Molecular Formula | C28H37N5O5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]azepan-1-yl]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C2CCCCCN2c2ccc(C(=O)NC(CO)C(C)(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H37N5O5/c1-28(2,3)23(16-34)32-25(35)18-10-13-21(20(15-18)27(37)38)33-14-6-4-5-7-22(33)26(36)31-19-11-8-17(9-12-19)24(29)30/h8-13,15,22-23,34H,4-7,14,16H2,1-3H3,(H3,29,30)(H,31,36)(H,32,35)(H,37,38) |
| InChIKey | ITMKWKZNPDLKSF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|