C31H37N5O5 — CID 21302437
2-[[2-(4-carbamimidoylanilino)-2-oxoethyl]-(2-phenylethyl)amino]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid (PubChem CID 21302437) has the molecular formula C31H37N5O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-[[2-(4-carbamimidoylanilino)-2-oxoethyl]-(2-phenylethyl)amino]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid.
| Compound Name | 2-[[2-(4-carbamimidoylanilino)-2-oxoethyl]-(2-phenylethyl)amino]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 21302437 |
| Molecular Formula | C31H37N5O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 2-[[2-(4-carbamimidoylanilino)-2-oxoethyl]-(2-phenylethyl)amino]-5-[(1-hydroxy-3,3-dimethylbutan-2-yl)carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CN(CCc2ccccc2)c2ccc(C(=O)NC(CO)C(C)(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H37N5O5/c1-31(2,3)26(19-37)35-29(39)22-11-14-25(24(17-22)30(40)41)36(16-15-20-7-5-4-6-8-20)18-27(38)34-23-12-9-21(10-13-23)28(32)33/h4-14,17,26,37H,15-16,18-19H2,1-3H3,(H3,32,33)(H,34,38)(H,35,39)(H,40,41) |
| InChIKey | ZLNANDDNIGEUPZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|