C17H15N3O — CID 21332124
1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one (PubChem CID 21332124) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one.
| Compound Name | 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 21332124 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one |
| SMILES | CC(=O)C(c1ccccc1)(c1ccccc1)n1cnnc1 |
| InChI | InChI=1S/C17H15N3O/c1-14(21)17(20-12-18-19-13-20,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | IQXZABPATZUJOG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |