About 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one
1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one (PubChem CID 21332124) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one.
Molecular Properties
| Compound Name | 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one |
| PubChem CID | 21332124 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one |
| SMILES | CC(=O)C(c1ccccc1)(c1ccccc1)n1cnnc1 |
| InChI | InChI=1S/C17H15N3O/c1-14(21)17(20-12-18-19-13-20,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | IQXZABPATZUJOG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one?
The IUPAC name of 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one (CID 21332124) is 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one.
What is the SMILES notation for 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one?
The canonical SMILES for 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one is CC(=O)C(c1ccccc1)(c1ccccc1)n1cnnc1.
What is the InChIKey of 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one?
The InChIKey is IQXZABPATZUJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c1-14(21)17(20-12-18-19-13-20,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13H,1H3.
What are the key properties of 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one?
1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one has a molecular weight of 277.33 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenyl-1-(1,2,4-triazol-4-yl)propan-2-one is sourced from PubChem (CID 21332124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).