C30H33N3O6S — CID 21357721
methyl 2-[2-(3,5-dimethylphenyl)-3-[1-[(4-nitrophenyl)sulfonylamino]propan-2-yl]-1H-indol-5-yl]-2-methylpropanoate (PubChem CID 21357721) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is methyl 2-[2-(3,5-dimethylphenyl)-3-[1-[(4-nitrophenyl)sulfonylamino]propan-2-yl]-1H-indol-5-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[2-(3,5-dimethylphenyl)-3-[1-[(4-nitrophenyl)sulfonylamino]propan-2-yl]-1H-indol-5-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 21357721 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | methyl 2-[2-(3,5-dimethylphenyl)-3-[1-[(4-nitrophenyl)sulfonylamino]propan-2-yl]-1H-indol-5-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1ccc2[nH]c(-c3cc(C)cc(C)c3)c(C(C)CNS(=O)(=O)c3ccc([N+](=O)[O-])cc3)c2c1 |
| InChI | InChI=1S/C30H33N3O6S/c1-18-13-19(2)15-21(14-18)28-27(25-16-22(7-12-26(25)32-28)30(4,5)29(34)39-6)20(3)17-31-40(37,38)24-10-8-23(9-11-24)33(35)36/h7-16,20,31-32H,17H2,1-6H3 |
| InChIKey | WBMSHAMRWSZOMC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|