C14H14ClN3OS — CID 21391423
3-[4-[(6-chloro-2-pyridinyl)sulfanyl]phenyl]-1,1-dimethylurea (PubChem CID 21391423) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 3-[4-[(6-chloro-2-pyridinyl)sulfanyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[(6-chloro-2-pyridinyl)sulfanyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 21391423 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-[4-[(6-chloro-2-pyridinyl)sulfanyl]phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Sc2cccc(Cl)n2)cc1 |
| InChI | InChI=1S/C14H14ClN3OS/c1-18(2)14(19)16-10-6-8-11(9-7-10)20-13-5-3-4-12(15)17-13/h3-9H,1-2H3,(H,16,19) |
| InChIKey | PIXDHKDAXXRHBT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|