About pyridin-1-ium-1-yl N-carbamoylcarbamate
pyridin-1-ium-1-yl N-carbamoylcarbamate (PubChem CID 21400932) has the molecular formula C7H8N3O3+
and a molecular weight of 182.16 g/mol. Its IUPAC name is pyridin-1-ium-1-yl N-carbamoylcarbamate.
Molecular Properties
| Compound Name | pyridin-1-ium-1-yl N-carbamoylcarbamate |
| PubChem CID | 21400932 |
| Molecular Formula | C7H8N3O3+ |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | pyridin-1-ium-1-yl N-carbamoylcarbamate |
| SMILES | NC(=O)NC(=O)O[n+]1ccccc1 |
| InChI | InChI=1S/C7H7N3O3/c8-6(11)9-7(12)13-10-4-2-1-3-5-10/h1-5H,(H2-,8,9,11,12)/p+1 |
| InChIKey | QSUVAFWRKBJXIS-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-yl N-carbamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-yl N-carbamoylcarbamate?
The IUPAC name of pyridin-1-ium-1-yl N-carbamoylcarbamate (CID 21400932) is pyridin-1-ium-1-yl N-carbamoylcarbamate.
What is the SMILES notation for pyridin-1-ium-1-yl N-carbamoylcarbamate?
The canonical SMILES for pyridin-1-ium-1-yl N-carbamoylcarbamate is NC(=O)NC(=O)O[n+]1ccccc1.
What is the InChIKey of pyridin-1-ium-1-yl N-carbamoylcarbamate?
The InChIKey is QSUVAFWRKBJXIS-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H7N3O3/c8-6(11)9-7(12)13-10-4-2-1-3-5-10/h1-5H,(H2-,8,9,11,12)/p+1.
What are the key properties of pyridin-1-ium-1-yl N-carbamoylcarbamate?
pyridin-1-ium-1-yl N-carbamoylcarbamate has a molecular weight of 182.16 g/mol, XLogP of -0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-yl N-carbamoylcarbamate is sourced from PubChem (CID 21400932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).