C22H29BrN4O6S2 — CID 21419479
N-(4-bromophenyl)sulfanyl-N-hexyl-4-[methyl(propyl)amino]-3,5-dinitrobenzenesulfonamide (PubChem CID 21419479) has the molecular formula C22H29BrN4O6S2 and a molecular weight of 589.53 g/mol. Its IUPAC name is N-(4-bromophenyl)sulfanyl-N-hexyl-4-[methyl(propyl)amino]-3,5-dinitrobenzenesulfonamide.
| Compound Name | N-(4-bromophenyl)sulfanyl-N-hexyl-4-[methyl(propyl)amino]-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 21419479 |
| Molecular Formula | C22H29BrN4O6S2 |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | N-(4-bromophenyl)sulfanyl-N-hexyl-4-[methyl(propyl)amino]-3,5-dinitrobenzenesulfonamide |
| SMILES | CCCCCCN(Sc1ccc(Br)cc1)S(=O)(=O)c1cc([N+](=O)[O-])c(N(C)CCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H29BrN4O6S2/c1-4-6-7-8-14-25(34-18-11-9-17(23)10-12-18)35(32,33)19-15-20(26(28)29)22(24(3)13-5-2)21(16-19)27(30)31/h9-12,15-16H,4-8,13-14H2,1-3H3 |
| InChIKey | ZMMLGLJZPLVRLQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|