C12H11N5O7 — CID 21429102
2-[(2,4-dinitrophenoxy)methyl]-1-ethyl-5-nitroimidazole (PubChem CID 21429102) has the molecular formula C12H11N5O7 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenoxy)methyl]-1-ethyl-5-nitroimidazole.
| Compound Name | 2-[(2,4-dinitrophenoxy)methyl]-1-ethyl-5-nitroimidazole |
|---|---|
| PubChem CID | 21429102 |
| Molecular Formula | C12H11N5O7 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[(2,4-dinitrophenoxy)methyl]-1-ethyl-5-nitroimidazole |
| SMILES | CCn1c([N+](=O)[O-])cnc1COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N5O7/c1-2-14-11(13-6-12(14)17(22)23)7-24-10-4-3-8(15(18)19)5-9(10)16(20)21/h3-6H,2,7H2,1H3 |
| InChIKey | WTVRCSQZPVLUPM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 156.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|