C9H18N2O2Si — CID 21438781
N-[ethenyl-methyl-(propanoylamino)silyl]propanamide (PubChem CID 21438781) has the molecular formula C9H18N2O2Si and a molecular weight of 214.34 g/mol. Its IUPAC name is N-[ethenyl-methyl-(propanoylamino)silyl]propanamide.
| Compound Name | N-[ethenyl-methyl-(propanoylamino)silyl]propanamide |
|---|---|
| PubChem CID | 21438781 |
| Molecular Formula | C9H18N2O2Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[ethenyl-methyl-(propanoylamino)silyl]propanamide |
| SMILES | C=C[Si](C)(NC(=O)CC)NC(=O)CC |
| InChI | InChI=1S/C9H18N2O2Si/c1-5-8(12)10-14(4,7-3)11-9(13)6-2/h7H,3,5-6H2,1-2,4H3,(H,10,12)(H,11,13) |
| InChIKey | VCQASPPAEZJPPP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|